C19H19N5O3S — CID 134540283
N-(2-hydroxyethyl)-4-[2-methyl-6-(prop-2-enoylamino)anilino]thieno[3,2-d]pyrimidine-7-carboxamide (PubChem CID 134540283) has the molecular formula C19H19N5O3S and a molecular weight of 397.46 g/mol. Its IUPAC name is N-(2-hydroxyethyl)-4-[2-methyl-6-(prop-2-enoylamino)anilino]thieno[3,2-d]pyrimidine-7-carboxamide.
| Compound Name | N-(2-hydroxyethyl)-4-[2-methyl-6-(prop-2-enoylamino)anilino]thieno[3,2-d]pyrimidine-7-carboxamide |
|---|---|
| PubChem CID | 134540283 |
| Molecular Formula | C19H19N5O3S |
| Molecular Weight | 397.46 g/mol |
| Exact Mass | 397.12 |
| IUPAC Name | N-(2-hydroxyethyl)-4-[2-methyl-6-(prop-2-enoylamino)anilino]thieno[3,2-d]pyrimidine-7-carboxamide |
| SMILES | C=CC(=O)Nc1cccc(C)c1Nc1ncnc2c(C(=O)NCCO)csc12 |
| InChI | InChI=1S/C19H19N5O3S/c1-3-14(26)23-13-6-4-5-11(2)15(13)24-18-17-16(21-10-22-18)12(9-28-17)19(27)20-7-8-25/h3-6,9-10,25H,1,7-8H2,2H3,(H,20,27)(H,23,26)(H,21,22,24) |
| InChIKey | RYAYKMWZPWEJJX-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 116.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.46 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|