C23H21Cl2N5O2S — CID 89252842
N-(2,6-dichloro-3-methoxy-5-methylphenyl)-4-[4-(dimethylamino)anilino]thieno[3,2-d]pyrimidine-7-carboxamide (PubChem CID 89252842) has the molecular formula C23H21Cl2N5O2S and a molecular weight of 502.43 g/mol. Its IUPAC name is N-(2,6-dichloro-3-methoxy-5-methylphenyl)-4-[4-(dimethylamino)anilino]thieno[3,2-d]pyrimidine-7-carboxamide.
| Compound Name | N-(2,6-dichloro-3-methoxy-5-methylphenyl)-4-[4-(dimethylamino)anilino]thieno[3,2-d]pyrimidine-7-carboxamide |
|---|---|
| PubChem CID | 89252842 |
| Molecular Formula | C23H21Cl2N5O2S |
| Molecular Weight | 502.43 g/mol |
| Exact Mass | 501.08 |
| IUPAC Name | N-(2,6-dichloro-3-methoxy-5-methylphenyl)-4-[4-(dimethylamino)anilino]thieno[3,2-d]pyrimidine-7-carboxamide |
| SMILES | COc1cc(C)c(Cl)c(NC(=O)c2csc3c(Nc4ccc(N(C)C)cc4)ncnc23)c1Cl |
| InChI | InChI=1S/C23H21Cl2N5O2S/c1-12-9-16(32-4)18(25)20(17(12)24)29-23(31)15-10-33-21-19(15)26-11-27-22(21)28-13-5-7-14(8-6-13)30(2)3/h5-11H,1-4H3,(H,29,31)(H,26,27,28) |
| InChIKey | AMAHJFFRKKEGRF-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.43 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|