C26H26IN5O4S — CID 89256358
N-(2-iodo-3,5-dimethoxy-6-methylphenyl)-4-(4-morpholin-4-ylanilino)thieno[3,2-d]pyrimidine-7-carboxamide (PubChem CID 89256358) has the molecular formula C26H26IN5O4S and a molecular weight of 631.50 g/mol. Its IUPAC name is N-(2-iodo-3,5-dimethoxy-6-methylphenyl)-4-(4-morpholin-4-ylanilino)thieno[3,2-d]pyrimidine-7-carboxamide.
| Compound Name | N-(2-iodo-3,5-dimethoxy-6-methylphenyl)-4-(4-morpholin-4-ylanilino)thieno[3,2-d]pyrimidine-7-carboxamide |
|---|---|
| PubChem CID | 89256358 |
| Molecular Formula | C26H26IN5O4S |
| Molecular Weight | 631.50 g/mol |
| Exact Mass | 631.08 |
| IUPAC Name | N-(2-iodo-3,5-dimethoxy-6-methylphenyl)-4-(4-morpholin-4-ylanilino)thieno[3,2-d]pyrimidine-7-carboxamide |
| SMILES | COc1cc(OC)c(I)c(NC(=O)c2csc3c(Nc4ccc(N5CCOCC5)cc4)ncnc23)c1C |
| InChI | InChI=1S/C26H26IN5O4S/c1-15-19(34-2)12-20(35-3)21(27)22(15)31-26(33)18-13-37-24-23(18)28-14-29-25(24)30-16-4-6-17(7-5-16)32-8-10-36-11-9-32/h4-7,12-14H,8-11H2,1-3H3,(H,31,33)(H,28,29,30) |
| InChIKey | LEEHENYKCIHTAB-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 97.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.50 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|