C22H22Cl2N6O3S — CID 87367644
N-(2,6-dichloro-3,5-dimethoxyphenyl)-4-(4-imidazol-1-ylbutylamino)thieno[3,2-d]pyrimidine-7-carboxamide (PubChem CID 87367644) has the molecular formula C22H22Cl2N6O3S and a molecular weight of 521.43 g/mol. Its IUPAC name is N-(2,6-dichloro-3,5-dimethoxyphenyl)-4-(4-imidazol-1-ylbutylamino)thieno[3,2-d]pyrimidine-7-carboxamide.
| Compound Name | N-(2,6-dichloro-3,5-dimethoxyphenyl)-4-(4-imidazol-1-ylbutylamino)thieno[3,2-d]pyrimidine-7-carboxamide |
|---|---|
| PubChem CID | 87367644 |
| Molecular Formula | C22H22Cl2N6O3S |
| Molecular Weight | 521.43 g/mol |
| Exact Mass | 520.09 |
| IUPAC Name | N-(2,6-dichloro-3,5-dimethoxyphenyl)-4-(4-imidazol-1-ylbutylamino)thieno[3,2-d]pyrimidine-7-carboxamide |
| SMILES | COc1cc(OC)c(Cl)c(NC(=O)c2csc3c(NCCCCn4ccnc4)ncnc23)c1Cl |
| InChI | InChI=1S/C22H22Cl2N6O3S/c1-32-14-9-15(33-2)17(24)19(16(14)23)29-22(31)13-10-34-20-18(13)27-11-28-21(20)26-5-3-4-7-30-8-6-25-12-30/h6,8-12H,3-5,7H2,1-2H3,(H,29,31)(H,26,27,28) |
| InChIKey | SJKCFPBZXKXCFW-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 103.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.43 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|