C19H17Cl2N5O4S2 — CID 89252826
ethyl N-[[7-[(2,6-dichloro-3-methoxy-5-methylphenyl)carbamoyl]thieno[3,2-d]pyrimidin-4-yl]carbamothioyl]carbamate (PubChem CID 89252826) has the molecular formula C19H17Cl2N5O4S2 and a molecular weight of 514.42 g/mol. Its IUPAC name is ethyl N-[[7-[(2,6-dichloro-3-methoxy-5-methylphenyl)carbamoyl]thieno[3,2-d]pyrimidin-4-yl]carbamothioyl]carbamate.
| Compound Name | ethyl N-[[7-[(2,6-dichloro-3-methoxy-5-methylphenyl)carbamoyl]thieno[3,2-d]pyrimidin-4-yl]carbamothioyl]carbamate |
|---|---|
| PubChem CID | 89252826 |
| Molecular Formula | C19H17Cl2N5O4S2 |
| Molecular Weight | 514.42 g/mol |
| Exact Mass | 513.01 |
| IUPAC Name | ethyl N-[[7-[(2,6-dichloro-3-methoxy-5-methylphenyl)carbamoyl]thieno[3,2-d]pyrimidin-4-yl]carbamothioyl]carbamate |
| SMILES | CCOC(=O)NC(=S)Nc1ncnc2c(C(=O)Nc3c(Cl)c(C)cc(OC)c3Cl)csc12 |
| InChI | InChI=1S/C19H17Cl2N5O4S2/c1-4-30-19(28)26-18(31)25-16-15-13(22-7-23-16)9(6-32-15)17(27)24-14-11(20)8(2)5-10(29-3)12(14)21/h5-7H,4H2,1-3H3,(H,24,27)(H2,22,23,25,26,28,31) |
| InChIKey | WMOHOYMVIUOWMJ-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 114.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.42 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|