C15H11Cl3N4O3S — CID 140601630
N-[3-(aminomethoxy)-2,4,6-trichloro-5-methoxyphenyl]thieno[3,2-d]pyrimidine-7-carboxamide (PubChem CID 140601630) has the molecular formula C15H11Cl3N4O3S and a molecular weight of 433.70 g/mol. Its IUPAC name is N-[3-(aminomethoxy)-2,4,6-trichloro-5-methoxyphenyl]thieno[3,2-d]pyrimidine-7-carboxamide.
| Compound Name | N-[3-(aminomethoxy)-2,4,6-trichloro-5-methoxyphenyl]thieno[3,2-d]pyrimidine-7-carboxamide |
|---|---|
| PubChem CID | 140601630 |
| Molecular Formula | C15H11Cl3N4O3S |
| Molecular Weight | 433.70 g/mol |
| Exact Mass | 431.96 |
| IUPAC Name | N-[3-(aminomethoxy)-2,4,6-trichloro-5-methoxyphenyl]thieno[3,2-d]pyrimidine-7-carboxamide |
| SMILES | COc1c(Cl)c(NC(=O)c2csc3cncnc23)c(Cl)c(OCN)c1Cl |
| InChI | InChI=1S/C15H11Cl3N4O3S/c1-24-13-8(16)12(9(17)14(10(13)18)25-4-19)22-15(23)6-3-26-7-2-20-5-21-11(6)7/h2-3,5H,4,19H2,1H3,(H,22,23) |
| InChIKey | VAXCSJDOMMEMHO-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 99.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.70 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|