C21H12BrCl2F3N4O2S — CID 89252891
N-(4-bromo-2,6-dichloro-3-methoxy-5-methylphenyl)-4-(2,3,4-trifluoroanilino)thieno[3,2-d]pyrimidine-7-carboxamide (PubChem CID 89252891) has the molecular formula C21H12BrCl2F3N4O2S and a molecular weight of 592.22 g/mol. Its IUPAC name is N-(4-bromo-2,6-dichloro-3-methoxy-5-methylphenyl)-4-(2,3,4-trifluoroanilino)thieno[3,2-d]pyrimidine-7-carboxamide.
| Compound Name | N-(4-bromo-2,6-dichloro-3-methoxy-5-methylphenyl)-4-(2,3,4-trifluoroanilino)thieno[3,2-d]pyrimidine-7-carboxamide |
|---|---|
| PubChem CID | 89252891 |
| Molecular Formula | C21H12BrCl2F3N4O2S |
| Molecular Weight | 592.22 g/mol |
| Exact Mass | 589.92 |
| IUPAC Name | N-(4-bromo-2,6-dichloro-3-methoxy-5-methylphenyl)-4-(2,3,4-trifluoroanilino)thieno[3,2-d]pyrimidine-7-carboxamide |
| SMILES | COc1c(Cl)c(NC(=O)c2csc3c(Nc4ccc(F)c(F)c4F)ncnc23)c(Cl)c(C)c1Br |
| InChI | InChI=1S/C21H12BrCl2F3N4O2S/c1-7-11(22)18(33-2)13(24)17(12(7)23)31-21(32)8-5-34-19-16(8)28-6-29-20(19)30-10-4-3-9(25)14(26)15(10)27/h3-6H,1-2H3,(H,31,32)(H,28,29,30) |
| InChIKey | LYYSXEYJEVYSQN-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.22 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|