C14H10FN3O2S — CID 102685977
3-fluoro-4-[(7-methylthieno[3,2-d]pyrimidin-4-yl)amino]benzoic acid (PubChem CID 102685977) has the molecular formula C14H10FN3O2S and a molecular weight of 303.32 g/mol. Its IUPAC name is 3-fluoro-4-[(7-methylthieno[3,2-d]pyrimidin-4-yl)amino]benzoic acid.
| Compound Name | 3-fluoro-4-[(7-methylthieno[3,2-d]pyrimidin-4-yl)amino]benzoic acid |
|---|---|
| PubChem CID | 102685977 |
| Molecular Formula | C14H10FN3O2S |
| Molecular Weight | 303.32 g/mol |
| Exact Mass | 303.05 |
| IUPAC Name | 3-fluoro-4-[(7-methylthieno[3,2-d]pyrimidin-4-yl)amino]benzoic acid |
| SMILES | Cc1csc2c(Nc3ccc(C(=O)O)cc3F)ncnc12 |
| InChI | InChI=1S/C14H10FN3O2S/c1-7-5-21-12-11(7)16-6-17-13(12)18-10-3-2-8(14(19)20)4-9(10)15/h2-6H,1H3,(H,19,20)(H,16,17,18) |
| InChIKey | CEXWTXVCUQVBEC-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.32 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |