C12H7ClFNO3S — CID 80644550
4-[(3-chlorothiophene-2-carbonyl)amino]-3-fluorobenzoic acid (PubChem CID 80644550) has the molecular formula C12H7ClFNO3S and a molecular weight of 299.71 g/mol. Its IUPAC name is 4-[(3-chlorothiophene-2-carbonyl)amino]-3-fluorobenzoic acid.
| Compound Name | 4-[(3-chlorothiophene-2-carbonyl)amino]-3-fluorobenzoic acid |
|---|---|
| PubChem CID | 80644550 |
| Molecular Formula | C12H7ClFNO3S |
| Molecular Weight | 299.71 g/mol |
| Exact Mass | 298.98 |
| IUPAC Name | 4-[(3-chlorothiophene-2-carbonyl)amino]-3-fluorobenzoic acid |
| SMILES | O=C(O)c1ccc(NC(=O)c2sccc2Cl)c(F)c1 |
| InChI | InChI=1S/C12H7ClFNO3S/c13-7-3-4-19-10(7)11(16)15-9-2-1-6(12(17)18)5-8(9)14/h1-5H,(H,15,16)(H,17,18) |
| InChIKey | QWGWXMQIAFFVRV-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.71 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |