C28H27N5O3 — CID 68913236
4-[[6-(2-methoxyphenyl)pyrimidin-4-yl]amino]-N-(4-morpholin-4-ylphenyl)benzamide (PubChem CID 68913236) has the molecular formula C28H27N5O3 and a molecular weight of 481.56 g/mol. Its IUPAC name is 4-[[6-(2-methoxyphenyl)pyrimidin-4-yl]amino]-N-(4-morpholin-4-ylphenyl)benzamide.
| Compound Name | 4-[[6-(2-methoxyphenyl)pyrimidin-4-yl]amino]-N-(4-morpholin-4-ylphenyl)benzamide |
|---|---|
| PubChem CID | 68913236 |
| Molecular Formula | C28H27N5O3 |
| Molecular Weight | 481.56 g/mol |
| Exact Mass | 481.21 |
| IUPAC Name | 4-[[6-(2-methoxyphenyl)pyrimidin-4-yl]amino]-N-(4-morpholin-4-ylphenyl)benzamide |
| SMILES | COc1ccccc1-c1cc(Nc2ccc(C(=O)Nc3ccc(N4CCOCC4)cc3)cc2)ncn1 |
| InChI | InChI=1S/C28H27N5O3/c1-35-26-5-3-2-4-24(26)25-18-27(30-19-29-25)31-21-8-6-20(7-9-21)28(34)32-22-10-12-23(13-11-22)33-14-16-36-17-15-33/h2-13,18-19H,14-17H2,1H3,(H,32,34)(H,29,30,31) |
| InChIKey | JAZIWVXWQJECOI-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 88.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.56 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|