C23H22FN3O3 — CID 59672860
3-fluoro-4-(3-methoxy-2-pyridinyl)-N-(4-morpholin-4-ylphenyl)benzamide (PubChem CID 59672860) has the molecular formula C23H22FN3O3 and a molecular weight of 407.45 g/mol. Its IUPAC name is 3-fluoro-4-(3-methoxy-2-pyridinyl)-N-(4-morpholin-4-ylphenyl)benzamide.
| Compound Name | 3-fluoro-4-(3-methoxy-2-pyridinyl)-N-(4-morpholin-4-ylphenyl)benzamide |
|---|---|
| PubChem CID | 59672860 |
| Molecular Formula | C23H22FN3O3 |
| Molecular Weight | 407.45 g/mol |
| Exact Mass | 407.16 |
| IUPAC Name | 3-fluoro-4-(3-methoxy-2-pyridinyl)-N-(4-morpholin-4-ylphenyl)benzamide |
| SMILES | COc1cccnc1-c1ccc(C(=O)Nc2ccc(N3CCOCC3)cc2)cc1F |
| InChI | InChI=1S/C23H22FN3O3/c1-29-21-3-2-10-25-22(21)19-9-4-16(15-20(19)24)23(28)26-17-5-7-18(8-6-17)27-11-13-30-14-12-27/h2-10,15H,11-14H2,1H3,(H,26,28) |
| InChIKey | WQOSIVOPZWEFRJ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.45 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|