C23H19F4N3O2 — CID 59673274
3-fluoro-N-(4-morpholin-4-ylphenyl)-4-[3-(trifluoromethyl)-2-pyridinyl]benzamide (PubChem CID 59673274) has the molecular formula C23H19F4N3O2 and a molecular weight of 445.42 g/mol. Its IUPAC name is 3-fluoro-N-(4-morpholin-4-ylphenyl)-4-[3-(trifluoromethyl)-2-pyridinyl]benzamide.
| Compound Name | 3-fluoro-N-(4-morpholin-4-ylphenyl)-4-[3-(trifluoromethyl)-2-pyridinyl]benzamide |
|---|---|
| PubChem CID | 59673274 |
| Molecular Formula | C23H19F4N3O2 |
| Molecular Weight | 445.42 g/mol |
| Exact Mass | 445.14 |
| IUPAC Name | 3-fluoro-N-(4-morpholin-4-ylphenyl)-4-[3-(trifluoromethyl)-2-pyridinyl]benzamide |
| SMILES | O=C(Nc1ccc(N2CCOCC2)cc1)c1ccc(-c2ncccc2C(F)(F)F)c(F)c1 |
| InChI | InChI=1S/C23H19F4N3O2/c24-20-14-15(3-8-18(20)21-19(23(25,26)27)2-1-9-28-21)22(31)29-16-4-6-17(7-5-16)30-10-12-32-13-11-30/h1-9,14H,10-13H2,(H,29,31) |
| InChIKey | ILSWKKWERNQMMV-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.42 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|