C20H13Cl2F3N2O2 — CID 59673140
3-chloro-N-(3-chloro-4-methoxyphenyl)-4-[3-(trifluoromethyl)-2-pyridinyl]benzamide (PubChem CID 59673140) has the molecular formula C20H13Cl2F3N2O2 and a molecular weight of 441.24 g/mol. Its IUPAC name is 3-chloro-N-(3-chloro-4-methoxyphenyl)-4-[3-(trifluoromethyl)-2-pyridinyl]benzamide.
| Compound Name | 3-chloro-N-(3-chloro-4-methoxyphenyl)-4-[3-(trifluoromethyl)-2-pyridinyl]benzamide |
|---|---|
| PubChem CID | 59673140 |
| Molecular Formula | C20H13Cl2F3N2O2 |
| Molecular Weight | 441.24 g/mol |
| Exact Mass | 440.03 |
| IUPAC Name | 3-chloro-N-(3-chloro-4-methoxyphenyl)-4-[3-(trifluoromethyl)-2-pyridinyl]benzamide |
| SMILES | COc1ccc(NC(=O)c2ccc(-c3ncccc3C(F)(F)F)c(Cl)c2)cc1Cl |
| InChI | InChI=1S/C20H13Cl2F3N2O2/c1-29-17-7-5-12(10-16(17)22)27-19(28)11-4-6-13(15(21)9-11)18-14(20(23,24)25)3-2-8-26-18/h2-10H,1H3,(H,27,28) |
| InChIKey | BMXDHYJICMEOFZ-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.24 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |