C24H23F3N2O2 — CID 59673054
N-(4-butylphenyl)-3-methoxy-4-[3-(trifluoromethyl)-2-pyridinyl]benzamide (PubChem CID 59673054) has the molecular formula C24H23F3N2O2 and a molecular weight of 428.45 g/mol. Its IUPAC name is N-(4-butylphenyl)-3-methoxy-4-[3-(trifluoromethyl)-2-pyridinyl]benzamide.
| Compound Name | N-(4-butylphenyl)-3-methoxy-4-[3-(trifluoromethyl)-2-pyridinyl]benzamide |
|---|---|
| PubChem CID | 59673054 |
| Molecular Formula | C24H23F3N2O2 |
| Molecular Weight | 428.45 g/mol |
| Exact Mass | 428.17 |
| IUPAC Name | N-(4-butylphenyl)-3-methoxy-4-[3-(trifluoromethyl)-2-pyridinyl]benzamide |
| SMILES | CCCCc1ccc(NC(=O)c2ccc(-c3ncccc3C(F)(F)F)c(OC)c2)cc1 |
| InChI | InChI=1S/C24H23F3N2O2/c1-3-4-6-16-8-11-18(12-9-16)29-23(30)17-10-13-19(21(15-17)31-2)22-20(24(25,26)27)7-5-14-28-22/h5,7-15H,3-4,6H2,1-2H3,(H,29,30) |
| InChIKey | OXBLTFZFCLWXAZ-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.45 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |