C23H25N5O4 — CID 122354917
3,5-dimethoxy-N-[4-[(5-morpholin-4-ylpyridazin-3-yl)amino]phenyl]benzamide (PubChem CID 122354917) has the molecular formula C23H25N5O4 and a molecular weight of 435.48 g/mol. Its IUPAC name is 3,5-dimethoxy-N-[4-[(5-morpholin-4-ylpyridazin-3-yl)amino]phenyl]benzamide.
| Compound Name | 3,5-dimethoxy-N-[4-[(5-morpholin-4-ylpyridazin-3-yl)amino]phenyl]benzamide |
|---|---|
| PubChem CID | 122354917 |
| Molecular Formula | C23H25N5O4 |
| Molecular Weight | 435.48 g/mol |
| Exact Mass | 435.19 |
| IUPAC Name | 3,5-dimethoxy-N-[4-[(5-morpholin-4-ylpyridazin-3-yl)amino]phenyl]benzamide |
| SMILES | COc1cc(OC)cc(C(=O)Nc2ccc(Nc3cc(N4CCOCC4)cnn3)cc2)c1 |
| InChI | InChI=1S/C23H25N5O4/c1-30-20-11-16(12-21(14-20)31-2)23(29)26-18-5-3-17(4-6-18)25-22-13-19(15-24-27-22)28-7-9-32-10-8-28/h3-6,11-15H,7-10H2,1-2H3,(H,25,27)(H,26,29) |
| InChIKey | RWVAEODWMCEOEQ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 97.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.48 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |