C22H23ClN6O2 — CID 122354963
1-(3-chloro-4-methylphenyl)-3-[4-[(5-morpholin-4-ylpyridazin-3-yl)amino]phenyl]urea (PubChem CID 122354963) has the molecular formula C22H23ClN6O2 and a molecular weight of 438.92 g/mol. Its IUPAC name is 1-(3-chloro-4-methylphenyl)-3-[4-[(5-morpholin-4-ylpyridazin-3-yl)amino]phenyl]urea.
| Compound Name | 1-(3-chloro-4-methylphenyl)-3-[4-[(5-morpholin-4-ylpyridazin-3-yl)amino]phenyl]urea |
|---|---|
| PubChem CID | 122354963 |
| Molecular Formula | C22H23ClN6O2 |
| Molecular Weight | 438.92 g/mol |
| Exact Mass | 438.16 |
| IUPAC Name | 1-(3-chloro-4-methylphenyl)-3-[4-[(5-morpholin-4-ylpyridazin-3-yl)amino]phenyl]urea |
| SMILES | Cc1ccc(NC(=O)Nc2ccc(Nc3cc(N4CCOCC4)cnn3)cc2)cc1Cl |
| InChI | InChI=1S/C22H23ClN6O2/c1-15-2-3-18(12-20(15)23)27-22(30)26-17-6-4-16(5-7-17)25-21-13-19(14-24-28-21)29-8-10-31-11-9-29/h2-7,12-14H,8-11H2,1H3,(H,25,28)(H2,26,27,30) |
| InChIKey | TZBUVSJQYMFNQD-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 91.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.92 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |