C23H25N5O2 — CID 122354908
2,4-dimethyl-N-[4-[(5-morpholin-4-ylpyridazin-3-yl)amino]phenyl]benzamide (PubChem CID 122354908) has the molecular formula C23H25N5O2 and a molecular weight of 403.49 g/mol. Its IUPAC name is 2,4-dimethyl-N-[4-[(5-morpholin-4-ylpyridazin-3-yl)amino]phenyl]benzamide.
| Compound Name | 2,4-dimethyl-N-[4-[(5-morpholin-4-ylpyridazin-3-yl)amino]phenyl]benzamide |
|---|---|
| PubChem CID | 122354908 |
| Molecular Formula | C23H25N5O2 |
| Molecular Weight | 403.49 g/mol |
| Exact Mass | 403.20 |
| IUPAC Name | 2,4-dimethyl-N-[4-[(5-morpholin-4-ylpyridazin-3-yl)amino]phenyl]benzamide |
| SMILES | Cc1ccc(C(=O)Nc2ccc(Nc3cc(N4CCOCC4)cnn3)cc2)c(C)c1 |
| InChI | InChI=1S/C23H25N5O2/c1-16-3-8-21(17(2)13-16)23(29)26-19-6-4-18(5-7-19)25-22-14-20(15-24-27-22)28-9-11-30-12-10-28/h3-8,13-15H,9-12H2,1-2H3,(H,25,27)(H,26,29) |
| InChIKey | YXLHLCIPRJGGJC-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.49 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |