C22H23N5O — CID 122354511
2-methyl-N-[4-[(5-pyrrolidin-1-ylpyridazin-3-yl)amino]phenyl]benzamide (PubChem CID 122354511) has the molecular formula C22H23N5O and a molecular weight of 373.46 g/mol. Its IUPAC name is 2-methyl-N-[4-[(5-pyrrolidin-1-ylpyridazin-3-yl)amino]phenyl]benzamide.
| Compound Name | 2-methyl-N-[4-[(5-pyrrolidin-1-ylpyridazin-3-yl)amino]phenyl]benzamide |
|---|---|
| PubChem CID | 122354511 |
| Molecular Formula | C22H23N5O |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.19 |
| IUPAC Name | 2-methyl-N-[4-[(5-pyrrolidin-1-ylpyridazin-3-yl)amino]phenyl]benzamide |
| SMILES | Cc1ccccc1C(=O)Nc1ccc(Nc2cc(N3CCCC3)cnn2)cc1 |
| InChI | InChI=1S/C22H23N5O/c1-16-6-2-3-7-20(16)22(28)25-18-10-8-17(9-11-18)24-21-14-19(15-23-26-21)27-12-4-5-13-27/h2-3,6-11,14-15H,4-5,12-13H2,1H3,(H,24,26)(H,25,28) |
| InChIKey | ZKPDGRPPDPPLRN-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |