C19H20N6OS — CID 122354873
1-[4-[(5-pyrrolidin-1-ylpyridazin-3-yl)amino]phenyl]-3-thiophen-2-ylurea (PubChem CID 122354873) has the molecular formula C19H20N6OS and a molecular weight of 380.48 g/mol. Its IUPAC name is 1-[4-[(5-pyrrolidin-1-ylpyridazin-3-yl)amino]phenyl]-3-thiophen-2-ylurea.
| Compound Name | 1-[4-[(5-pyrrolidin-1-ylpyridazin-3-yl)amino]phenyl]-3-thiophen-2-ylurea |
|---|---|
| PubChem CID | 122354873 |
| Molecular Formula | C19H20N6OS |
| Molecular Weight | 380.48 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | 1-[4-[(5-pyrrolidin-1-ylpyridazin-3-yl)amino]phenyl]-3-thiophen-2-ylurea |
| SMILES | O=C(Nc1ccc(Nc2cc(N3CCCC3)cnn2)cc1)Nc1cccs1 |
| InChI | InChI=1S/C19H20N6OS/c26-19(23-18-4-3-11-27-18)22-15-7-5-14(6-8-15)21-17-12-16(13-20-24-17)25-9-1-2-10-25/h3-8,11-13H,1-2,9-10H2,(H,21,24)(H2,22,23,26) |
| InChIKey | YHDPBMHOWXOHCW-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 82.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.48 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |