C16H19N3OS — CID 108889200
1-(4-piperidin-1-ylphenyl)-3-thiophen-2-ylurea (PubChem CID 108889200) has the molecular formula C16H19N3OS and a molecular weight of 301.42 g/mol. Its IUPAC name is 1-(4-piperidin-1-ylphenyl)-3-thiophen-2-ylurea.
| Compound Name | 1-(4-piperidin-1-ylphenyl)-3-thiophen-2-ylurea |
|---|---|
| PubChem CID | 108889200 |
| Molecular Formula | C16H19N3OS |
| Molecular Weight | 301.42 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | 1-(4-piperidin-1-ylphenyl)-3-thiophen-2-ylurea |
| SMILES | O=C(Nc1ccc(N2CCCCC2)cc1)Nc1cccs1 |
| InChI | InChI=1S/C16H19N3OS/c20-16(18-15-5-4-12-21-15)17-13-6-8-14(9-7-13)19-10-2-1-3-11-19/h4-9,12H,1-3,10-11H2,(H2,17,18,20) |
| InChIKey | DQOGTOPGXUUGAH-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.42 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|