C18H19Cl2N3O — CID 108992520
1-(3,5-dichlorophenyl)-3-(4-piperidin-1-ylphenyl)urea (PubChem CID 108992520) has the molecular formula C18H19Cl2N3O and a molecular weight of 364.28 g/mol. Its IUPAC name is 1-(3,5-dichlorophenyl)-3-(4-piperidin-1-ylphenyl)urea.
| Compound Name | 1-(3,5-dichlorophenyl)-3-(4-piperidin-1-ylphenyl)urea |
|---|---|
| PubChem CID | 108992520 |
| Molecular Formula | C18H19Cl2N3O |
| Molecular Weight | 364.28 g/mol |
| Exact Mass | 363.09 |
| IUPAC Name | 1-(3,5-dichlorophenyl)-3-(4-piperidin-1-ylphenyl)urea |
| SMILES | O=C(Nc1ccc(N2CCCCC2)cc1)Nc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C18H19Cl2N3O/c19-13-10-14(20)12-16(11-13)22-18(24)21-15-4-6-17(7-5-15)23-8-2-1-3-9-23/h4-7,10-12H,1-3,8-9H2,(H2,21,22,24) |
| InChIKey | FWDNGBJCLVGJSW-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.28 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|