C18H17Cl2N3O2 — CID 108987617
N'-(2,5-dichlorophenyl)-N-(4-pyrrolidin-1-ylphenyl)oxamide (PubChem CID 108987617) has the molecular formula C18H17Cl2N3O2 and a molecular weight of 378.26 g/mol. Its IUPAC name is N'-(2,5-dichlorophenyl)-N-(4-pyrrolidin-1-ylphenyl)oxamide.
| Compound Name | N'-(2,5-dichlorophenyl)-N-(4-pyrrolidin-1-ylphenyl)oxamide |
|---|---|
| PubChem CID | 108987617 |
| Molecular Formula | C18H17Cl2N3O2 |
| Molecular Weight | 378.26 g/mol |
| Exact Mass | 377.07 |
| IUPAC Name | N'-(2,5-dichlorophenyl)-N-(4-pyrrolidin-1-ylphenyl)oxamide |
| SMILES | O=C(Nc1ccc(N2CCCC2)cc1)C(=O)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C18H17Cl2N3O2/c19-12-3-8-15(20)16(11-12)22-18(25)17(24)21-13-4-6-14(7-5-13)23-9-1-2-10-23/h3-8,11H,1-2,9-10H2,(H,21,24)(H,22,25) |
| InChIKey | KKLRCDZVVXFEFP-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.26 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|