C23H22N6OS — CID 122297869
1-[4-[[2-methyl-6-(4-methylanilino)pyrimidin-4-yl]amino]phenyl]-3-thiophen-2-ylurea (PubChem CID 122297869) has the molecular formula C23H22N6OS and a molecular weight of 430.54 g/mol. Its IUPAC name is 1-[4-[[2-methyl-6-(4-methylanilino)pyrimidin-4-yl]amino]phenyl]-3-thiophen-2-ylurea.
| Compound Name | 1-[4-[[2-methyl-6-(4-methylanilino)pyrimidin-4-yl]amino]phenyl]-3-thiophen-2-ylurea |
|---|---|
| PubChem CID | 122297869 |
| Molecular Formula | C23H22N6OS |
| Molecular Weight | 430.54 g/mol |
| Exact Mass | 430.16 |
| IUPAC Name | 1-[4-[[2-methyl-6-(4-methylanilino)pyrimidin-4-yl]amino]phenyl]-3-thiophen-2-ylurea |
| SMILES | Cc1ccc(Nc2cc(Nc3ccc(NC(=O)Nc4cccs4)cc3)nc(C)n2)cc1 |
| InChI | InChI=1S/C23H22N6OS/c1-15-5-7-17(8-6-15)26-20-14-21(25-16(2)24-20)27-18-9-11-19(12-10-18)28-23(30)29-22-4-3-13-31-22/h3-14H,1-2H3,(H2,28,29,30)(H2,24,25,26,27) |
| InChIKey | KSQYAYQRECDXSB-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 90.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.54 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |