C23H26N6O2 — CID 122354978
1-(2,3-dimethylphenyl)-3-[4-[(5-morpholin-4-ylpyridazin-3-yl)amino]phenyl]urea (PubChem CID 122354978) has the molecular formula C23H26N6O2 and a molecular weight of 418.50 g/mol. Its IUPAC name is 1-(2,3-dimethylphenyl)-3-[4-[(5-morpholin-4-ylpyridazin-3-yl)amino]phenyl]urea.
| Compound Name | 1-(2,3-dimethylphenyl)-3-[4-[(5-morpholin-4-ylpyridazin-3-yl)amino]phenyl]urea |
|---|---|
| PubChem CID | 122354978 |
| Molecular Formula | C23H26N6O2 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.21 |
| IUPAC Name | 1-(2,3-dimethylphenyl)-3-[4-[(5-morpholin-4-ylpyridazin-3-yl)amino]phenyl]urea |
| SMILES | Cc1cccc(NC(=O)Nc2ccc(Nc3cc(N4CCOCC4)cnn3)cc2)c1C |
| InChI | InChI=1S/C23H26N6O2/c1-16-4-3-5-21(17(16)2)27-23(30)26-19-8-6-18(7-9-19)25-22-14-20(15-24-28-22)29-10-12-31-13-11-29/h3-9,14-15H,10-13H2,1-2H3,(H,25,28)(H2,26,27,30) |
| InChIKey | XQGBWQKBAYXTCV-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 91.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |