C19H26N6O — CID 122321078
1-(2,3-dimethylphenyl)-3-[2-[(5-pyrrolidin-1-ylpyridazin-3-yl)amino]ethyl]urea (PubChem CID 122321078) has the molecular formula C19H26N6O and a molecular weight of 354.46 g/mol. Its IUPAC name is 1-(2,3-dimethylphenyl)-3-[2-[(5-pyrrolidin-1-ylpyridazin-3-yl)amino]ethyl]urea.
| Compound Name | 1-(2,3-dimethylphenyl)-3-[2-[(5-pyrrolidin-1-ylpyridazin-3-yl)amino]ethyl]urea |
|---|---|
| PubChem CID | 122321078 |
| Molecular Formula | C19H26N6O |
| Molecular Weight | 354.46 g/mol |
| Exact Mass | 354.22 |
| IUPAC Name | 1-(2,3-dimethylphenyl)-3-[2-[(5-pyrrolidin-1-ylpyridazin-3-yl)amino]ethyl]urea |
| SMILES | Cc1cccc(NC(=O)NCCNc2cc(N3CCCC3)cnn2)c1C |
| InChI | InChI=1S/C19H26N6O/c1-14-6-5-7-17(15(14)2)23-19(26)21-9-8-20-18-12-16(13-22-24-18)25-10-3-4-11-25/h5-7,12-13H,3-4,8-11H2,1-2H3,(H,20,24)(H2,21,23,26) |
| InChIKey | FACOTQIOFNBBNO-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 82.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.46 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|