C22H22BrN5O3 — CID 122355154
2-bromo-5-methoxy-N-[4-[(5-morpholin-4-ylpyridazin-3-yl)amino]phenyl]benzamide (PubChem CID 122355154) has the molecular formula C22H22BrN5O3 and a molecular weight of 484.35 g/mol. Its IUPAC name is 2-bromo-5-methoxy-N-[4-[(5-morpholin-4-ylpyridazin-3-yl)amino]phenyl]benzamide.
| Compound Name | 2-bromo-5-methoxy-N-[4-[(5-morpholin-4-ylpyridazin-3-yl)amino]phenyl]benzamide |
|---|---|
| PubChem CID | 122355154 |
| Molecular Formula | C22H22BrN5O3 |
| Molecular Weight | 484.35 g/mol |
| Exact Mass | 483.09 |
| IUPAC Name | 2-bromo-5-methoxy-N-[4-[(5-morpholin-4-ylpyridazin-3-yl)amino]phenyl]benzamide |
| SMILES | COc1ccc(Br)c(C(=O)Nc2ccc(Nc3cc(N4CCOCC4)cnn3)cc2)c1 |
| InChI | InChI=1S/C22H22BrN5O3/c1-30-18-6-7-20(23)19(13-18)22(29)26-16-4-2-15(3-5-16)25-21-12-17(14-24-27-21)28-8-10-31-11-9-28/h2-7,12-14H,8-11H2,1H3,(H,25,27)(H,26,29) |
| InChIKey | GTMDGAGODVEGQK-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 88.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.35 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |