C14H19N3O4S — CID 166420577
N-[2-(ethylsulfonylamino)ethyl]-2-(prop-2-enoylamino)benzamide (PubChem CID 166420577) has the molecular formula C14H19N3O4S and a molecular weight of 325.39 g/mol. Its IUPAC name is N-[2-(ethylsulfonylamino)ethyl]-2-(prop-2-enoylamino)benzamide.
| Compound Name | N-[2-(ethylsulfonylamino)ethyl]-2-(prop-2-enoylamino)benzamide |
|---|---|
| PubChem CID | 166420577 |
| Molecular Formula | C14H19N3O4S |
| Molecular Weight | 325.39 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | N-[2-(ethylsulfonylamino)ethyl]-2-(prop-2-enoylamino)benzamide |
| SMILES | C=CC(=O)Nc1ccccc1C(=O)NCCNS(=O)(=O)CC |
| InChI | InChI=1S/C14H19N3O4S/c1-3-13(18)17-12-8-6-5-7-11(12)14(19)15-9-10-16-22(20,21)4-2/h3,5-8,16H,1,4,9-10H2,2H3,(H,15,19)(H,17,18) |
| InChIKey | CQIBZQSOCUEZTE-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.39 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|