C11H16N2O3S2 — CID 108573441
N-[2-(ethylsulfonylamino)ethyl]-2-sulfanylbenzamide (PubChem CID 108573441) has the molecular formula C11H16N2O3S2 and a molecular weight of 288.39 g/mol. Its IUPAC name is N-[2-(ethylsulfonylamino)ethyl]-2-sulfanylbenzamide.
| Compound Name | N-[2-(ethylsulfonylamino)ethyl]-2-sulfanylbenzamide |
|---|---|
| PubChem CID | 108573441 |
| Molecular Formula | C11H16N2O3S2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.06 |
| IUPAC Name | N-[2-(ethylsulfonylamino)ethyl]-2-sulfanylbenzamide |
| SMILES | CCS(=O)(=O)NCCNC(=O)c1ccccc1S |
| InChI | InChI=1S/C11H16N2O3S2/c1-2-18(15,16)13-8-7-12-11(14)9-5-3-4-6-10(9)17/h3-6,13,17H,2,7-8H2,1H3,(H,12,14) |
| InChIKey | VREXBBIODWJMCS-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|