C18H22N6O2 — CID 138515980
1-[(4aR)-8-[[6-(methylamino)pyrimidin-4-yl]amino]-2,4,4a,5-tetrahydro-1H-pyrazino[2,1-c][1,4]benzoxazin-3-yl]ethanone (PubChem CID 138515980) has the molecular formula C18H22N6O2 and a molecular weight of 354.41 g/mol. Its IUPAC name is 1-[(4aR)-8-[[6-(methylamino)pyrimidin-4-yl]amino]-2,4,4a,5-tetrahydro-1H-pyrazino[2,1-c][1,4]benzoxazin-3-yl]ethanone.
| Compound Name | 1-[(4aR)-8-[[6-(methylamino)pyrimidin-4-yl]amino]-2,4,4a,5-tetrahydro-1H-pyrazino[2,1-c][1,4]benzoxazin-3-yl]ethanone |
|---|---|
| PubChem CID | 138515980 |
| Molecular Formula | C18H22N6O2 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | 1-[(4aR)-8-[[6-(methylamino)pyrimidin-4-yl]amino]-2,4,4a,5-tetrahydro-1H-pyrazino[2,1-c][1,4]benzoxazin-3-yl]ethanone |
| SMILES | CNc1cc(Nc2ccc3c(c2)OC[C@H]2CN(C(C)=O)CCN32)ncn1 |
| InChI | InChI=1S/C18H22N6O2/c1-12(25)23-5-6-24-14(9-23)10-26-16-7-13(3-4-15(16)24)22-18-8-17(19-2)20-11-21-18/h3-4,7-8,11,14H,5-6,9-10H2,1-2H3,(H2,19,20,21,22)/t14-/m1/s1 |
| InChIKey | JFXTXFZEHYGSSL-CQSZACIVSA-N |
| XLogP | 1.69 |
| TPSA | 82.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |