C24H29N7O3 — CID 164788089
3-(3,5-dimethoxyphenyl)-1-methyl-1-[6-(4-piperazin-1-ylanilino)pyrimidin-4-yl]urea (PubChem CID 164788089) has the molecular formula C24H29N7O3 and a molecular weight of 463.54 g/mol. Its IUPAC name is 3-(3,5-dimethoxyphenyl)-1-methyl-1-[6-(4-piperazin-1-ylanilino)pyrimidin-4-yl]urea.
| Compound Name | 3-(3,5-dimethoxyphenyl)-1-methyl-1-[6-(4-piperazin-1-ylanilino)pyrimidin-4-yl]urea |
|---|---|
| PubChem CID | 164788089 |
| Molecular Formula | C24H29N7O3 |
| Molecular Weight | 463.54 g/mol |
| Exact Mass | 463.23 |
| IUPAC Name | 3-(3,5-dimethoxyphenyl)-1-methyl-1-[6-(4-piperazin-1-ylanilino)pyrimidin-4-yl]urea |
| SMILES | COc1cc(NC(=O)N(C)c2cc(Nc3ccc(N4CCNCC4)cc3)ncn2)cc(OC)c1 |
| InChI | InChI=1S/C24H29N7O3/c1-30(24(32)29-18-12-20(33-2)14-21(13-18)34-3)23-15-22(26-16-27-23)28-17-4-6-19(7-5-17)31-10-8-25-9-11-31/h4-7,12-16,25H,8-11H2,1-3H3,(H,29,32)(H,26,27,28) |
| InChIKey | DLPZFCGSETYOOG-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 103.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.54 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|