C26H32ClN7O3 — CID 56594742
3-(2-chloro-3,5-dimethoxyphenyl)-1-ethyl-1-[6-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]urea (PubChem CID 56594742) has the molecular formula C26H32ClN7O3 and a molecular weight of 526.04 g/mol. Its IUPAC name is 3-(2-chloro-3,5-dimethoxyphenyl)-1-ethyl-1-[6-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]urea.
| Compound Name | 3-(2-chloro-3,5-dimethoxyphenyl)-1-ethyl-1-[6-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]urea |
|---|---|
| PubChem CID | 56594742 |
| Molecular Formula | C26H32ClN7O3 |
| Molecular Weight | 526.04 g/mol |
| Exact Mass | 525.23 |
| IUPAC Name | 3-(2-chloro-3,5-dimethoxyphenyl)-1-ethyl-1-[6-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]urea |
| SMILES | CCN(C(=O)Nc1cc(OC)cc(OC)c1Cl)c1cc(Nc2ccc(N3CCN(C)CC3)cc2)ncn1 |
| InChI | InChI=1S/C26H32ClN7O3/c1-5-34(26(35)31-21-14-20(36-3)15-22(37-4)25(21)27)24-16-23(28-17-29-24)30-18-6-8-19(9-7-18)33-12-10-32(2)11-13-33/h6-9,14-17H,5,10-13H2,1-4H3,(H,31,35)(H,28,29,30) |
| InChIKey | LJQYAVSTCHESEI-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 95.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.04 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|