C34H41N7O3 — CID 118899272
3-(2,6-diethylphenyl)-1-(2,4-dimethoxyphenyl)-1-[6-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]urea (PubChem CID 118899272) has the molecular formula C34H41N7O3 and a molecular weight of 595.75 g/mol. Its IUPAC name is 3-(2,6-diethylphenyl)-1-(2,4-dimethoxyphenyl)-1-[6-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]urea.
| Compound Name | 3-(2,6-diethylphenyl)-1-(2,4-dimethoxyphenyl)-1-[6-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]urea |
|---|---|
| PubChem CID | 118899272 |
| Molecular Formula | C34H41N7O3 |
| Molecular Weight | 595.75 g/mol |
| Exact Mass | 595.33 |
| IUPAC Name | 3-(2,6-diethylphenyl)-1-(2,4-dimethoxyphenyl)-1-[6-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]urea |
| SMILES | CCc1cccc(CC)c1NC(=O)N(c1cc(Nc2ccc(N3CCN(C)CC3)cc2)ncn1)c1ccc(OC)cc1OC |
| InChI | InChI=1S/C34H41N7O3/c1-6-24-9-8-10-25(7-2)33(24)38-34(42)41(29-16-15-28(43-4)21-30(29)44-5)32-22-31(35-23-36-32)37-26-11-13-27(14-12-26)40-19-17-39(3)18-20-40/h8-16,21-23H,6-7,17-20H2,1-5H3,(H,38,42)(H,35,36,37) |
| InChIKey | FWLHJTGPSDMILZ-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 95.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.75 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|