C35H43N7O3 — CID 139471879
4-N-[3-(2,6-diethylanilino)oxiran-2-yl]-6-N-(2,4-dimethoxyphenyl)-4-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrimidine-4,6-diamine (PubChem CID 139471879) has the molecular formula C35H43N7O3 and a molecular weight of 609.78 g/mol. Its IUPAC name is 4-N-[3-(2,6-diethylanilino)oxiran-2-yl]-6-N-(2,4-dimethoxyphenyl)-4-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrimidine-4,6-diamine.
| Compound Name | 4-N-[3-(2,6-diethylanilino)oxiran-2-yl]-6-N-(2,4-dimethoxyphenyl)-4-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 139471879 |
| Molecular Formula | C35H43N7O3 |
| Molecular Weight | 609.78 g/mol |
| Exact Mass | 609.34 |
| IUPAC Name | 4-N-[3-(2,6-diethylanilino)oxiran-2-yl]-6-N-(2,4-dimethoxyphenyl)-4-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrimidine-4,6-diamine |
| SMILES | CCc1cccc(CC)c1NC1OC1N(c1ccc(N2CCN(C)CC2)cc1)c1cc(Nc2ccc(OC)cc2OC)ncn1 |
| InChI | InChI=1S/C35H43N7O3/c1-6-24-9-8-10-25(7-2)33(24)39-34-35(45-34)42(27-13-11-26(12-14-27)41-19-17-40(3)18-20-41)32-22-31(36-23-37-32)38-29-16-15-28(43-4)21-30(29)44-5/h8-16,21-23,34-35,39H,6-7,17-20H2,1-5H3,(H,36,37,38) |
| InChIKey | OXAOFCYELFNDLK-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 90.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.78 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|