C17H23N5O2 — CID 99968422
N-(2,5-dimethoxyphenyl)-6-(4-methylpiperazin-1-yl)pyrimidin-4-amine (PubChem CID 99968422) has the molecular formula C17H23N5O2 and a molecular weight of 329.40 g/mol. Its IUPAC name is N-(2,5-dimethoxyphenyl)-6-(4-methylpiperazin-1-yl)pyrimidin-4-amine.
| Compound Name | N-(2,5-dimethoxyphenyl)-6-(4-methylpiperazin-1-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 99968422 |
| Molecular Formula | C17H23N5O2 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.19 |
| IUPAC Name | N-(2,5-dimethoxyphenyl)-6-(4-methylpiperazin-1-yl)pyrimidin-4-amine |
| SMILES | COc1ccc(OC)c(Nc2cc(N3CCN(C)CC3)ncn2)c1 |
| InChI | InChI=1S/C17H23N5O2/c1-21-6-8-22(9-7-21)17-11-16(18-12-19-17)20-14-10-13(23-2)4-5-15(14)24-3/h4-5,10-12H,6-9H2,1-3H3,(H,18,19,20) |
| InChIKey | AYCDGBDFUZOUOZ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 62.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |