C17H21N5O3 — CID 112858317
4-[6-(2,4-dimethoxyanilino)pyrimidin-4-yl]piperazine-1-carbaldehyde (PubChem CID 112858317) has the molecular formula C17H21N5O3 and a molecular weight of 343.39 g/mol. Its IUPAC name is 4-[6-(2,4-dimethoxyanilino)pyrimidin-4-yl]piperazine-1-carbaldehyde.
| Compound Name | 4-[6-(2,4-dimethoxyanilino)pyrimidin-4-yl]piperazine-1-carbaldehyde |
|---|---|
| PubChem CID | 112858317 |
| Molecular Formula | C17H21N5O3 |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | 4-[6-(2,4-dimethoxyanilino)pyrimidin-4-yl]piperazine-1-carbaldehyde |
| SMILES | COc1ccc(Nc2cc(N3CCN(C=O)CC3)ncn2)c(OC)c1 |
| InChI | InChI=1S/C17H21N5O3/c1-24-13-3-4-14(15(9-13)25-2)20-16-10-17(19-11-18-16)22-7-5-21(12-23)6-8-22/h3-4,9-12H,5-8H2,1-2H3,(H,18,19,20) |
| InChIKey | UPOSPWRBRDHJMK-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|