C17H21N5O — CID 112858278
4-[6-(3,4-dimethylanilino)pyrimidin-4-yl]piperazine-1-carbaldehyde (PubChem CID 112858278) has the molecular formula C17H21N5O and a molecular weight of 311.39 g/mol. Its IUPAC name is 4-[6-(3,4-dimethylanilino)pyrimidin-4-yl]piperazine-1-carbaldehyde.
| Compound Name | 4-[6-(3,4-dimethylanilino)pyrimidin-4-yl]piperazine-1-carbaldehyde |
|---|---|
| PubChem CID | 112858278 |
| Molecular Formula | C17H21N5O |
| Molecular Weight | 311.39 g/mol |
| Exact Mass | 311.17 |
| IUPAC Name | 4-[6-(3,4-dimethylanilino)pyrimidin-4-yl]piperazine-1-carbaldehyde |
| SMILES | Cc1ccc(Nc2cc(N3CCN(C=O)CC3)ncn2)cc1C |
| InChI | InChI=1S/C17H21N5O/c1-13-3-4-15(9-14(13)2)20-16-10-17(19-11-18-16)22-7-5-21(12-23)6-8-22/h3-4,9-12H,5-8H2,1-2H3,(H,18,19,20) |
| InChIKey | GAHAQFQCDIYXOL-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.39 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|