C16H21N5S — CID 99968435
6-(4-methylpiperazin-1-yl)-N-(2-methylsulfanylphenyl)pyrimidin-4-amine (PubChem CID 99968435) has the molecular formula C16H21N5S and a molecular weight of 315.45 g/mol. Its IUPAC name is 6-(4-methylpiperazin-1-yl)-N-(2-methylsulfanylphenyl)pyrimidin-4-amine.
| Compound Name | 6-(4-methylpiperazin-1-yl)-N-(2-methylsulfanylphenyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 99968435 |
| Molecular Formula | C16H21N5S |
| Molecular Weight | 315.45 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | 6-(4-methylpiperazin-1-yl)-N-(2-methylsulfanylphenyl)pyrimidin-4-amine |
| SMILES | CSc1ccccc1Nc1cc(N2CCN(C)CC2)ncn1 |
| InChI | InChI=1S/C16H21N5S/c1-20-7-9-21(10-8-20)16-11-15(17-12-18-16)19-13-5-3-4-6-14(13)22-2/h3-6,11-12H,7-10H2,1-2H3,(H,17,18,19) |
| InChIKey | OGALVFDUZVOEPQ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.45 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |