C16H20FN5 — CID 112858117
6-(4-ethylpiperazin-1-yl)-N-(2-fluorophenyl)pyrimidin-4-amine (PubChem CID 112858117) has the molecular formula C16H20FN5 and a molecular weight of 301.37 g/mol. Its IUPAC name is 6-(4-ethylpiperazin-1-yl)-N-(2-fluorophenyl)pyrimidin-4-amine.
| Compound Name | 6-(4-ethylpiperazin-1-yl)-N-(2-fluorophenyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 112858117 |
| Molecular Formula | C16H20FN5 |
| Molecular Weight | 301.37 g/mol |
| Exact Mass | 301.17 |
| IUPAC Name | 6-(4-ethylpiperazin-1-yl)-N-(2-fluorophenyl)pyrimidin-4-amine |
| SMILES | CCN1CCN(c2cc(Nc3ccccc3F)ncn2)CC1 |
| InChI | InChI=1S/C16H20FN5/c1-2-21-7-9-22(10-8-21)16-11-15(18-12-19-16)20-14-6-4-3-5-13(14)17/h3-6,11-12H,2,7-10H2,1H3,(H,18,19,20) |
| InChIKey | HLLWUIOERDBZIY-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.37 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |