C20H29N5 — CID 112858113
N-(2,6-diethylphenyl)-6-(4-ethylpiperazin-1-yl)pyrimidin-4-amine (PubChem CID 112858113) has the molecular formula C20H29N5 and a molecular weight of 339.49 g/mol. Its IUPAC name is N-(2,6-diethylphenyl)-6-(4-ethylpiperazin-1-yl)pyrimidin-4-amine.
| Compound Name | N-(2,6-diethylphenyl)-6-(4-ethylpiperazin-1-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 112858113 |
| Molecular Formula | C20H29N5 |
| Molecular Weight | 339.49 g/mol |
| Exact Mass | 339.24 |
| IUPAC Name | N-(2,6-diethylphenyl)-6-(4-ethylpiperazin-1-yl)pyrimidin-4-amine |
| SMILES | CCc1cccc(CC)c1Nc1cc(N2CCN(CC)CC2)ncn1 |
| InChI | InChI=1S/C20H29N5/c1-4-16-8-7-9-17(5-2)20(16)23-18-14-19(22-15-21-18)25-12-10-24(6-3)11-13-25/h7-9,14-15H,4-6,10-13H2,1-3H3,(H,21,22,23) |
| InChIKey | MHSHSUSNSRWUOF-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.49 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |