C28H36N6O4 — CID 118899314
tert-butyl N-[6-(2,4-dimethoxyanilino)pyrimidin-4-yl]-N-[4-(4-methylpiperazin-1-yl)phenyl]carbamate (PubChem CID 118899314) has the molecular formula C28H36N6O4 and a molecular weight of 520.63 g/mol. Its IUPAC name is tert-butyl N-[6-(2,4-dimethoxyanilino)pyrimidin-4-yl]-N-[4-(4-methylpiperazin-1-yl)phenyl]carbamate.
| Compound Name | tert-butyl N-[6-(2,4-dimethoxyanilino)pyrimidin-4-yl]-N-[4-(4-methylpiperazin-1-yl)phenyl]carbamate |
|---|---|
| PubChem CID | 118899314 |
| Molecular Formula | C28H36N6O4 |
| Molecular Weight | 520.63 g/mol |
| Exact Mass | 520.28 |
| IUPAC Name | tert-butyl N-[6-(2,4-dimethoxyanilino)pyrimidin-4-yl]-N-[4-(4-methylpiperazin-1-yl)phenyl]carbamate |
| SMILES | COc1ccc(Nc2cc(N(C(=O)OC(C)(C)C)c3ccc(N4CCN(C)CC4)cc3)ncn2)c(OC)c1 |
| InChI | InChI=1S/C28H36N6O4/c1-28(2,3)38-27(35)34(21-9-7-20(8-10-21)33-15-13-32(4)14-16-33)26-18-25(29-19-30-26)31-23-12-11-22(36-5)17-24(23)37-6/h7-12,17-19H,13-16H2,1-6H3,(H,29,30,31) |
| InChIKey | KBPRBYKCOUNDGJ-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 92.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.63 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|