C25H30ClN7O2 — CID 166717532
3-(2-chloro-5-methoxy-3-methylphenyl)-1-methyl-1-[6-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]urea (PubChem CID 166717532) has the molecular formula C25H30ClN7O2 and a molecular weight of 496.02 g/mol. Its IUPAC name is 3-(2-chloro-5-methoxy-3-methylphenyl)-1-methyl-1-[6-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]urea.
| Compound Name | 3-(2-chloro-5-methoxy-3-methylphenyl)-1-methyl-1-[6-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]urea |
|---|---|
| PubChem CID | 166717532 |
| Molecular Formula | C25H30ClN7O2 |
| Molecular Weight | 496.02 g/mol |
| Exact Mass | 495.21 |
| IUPAC Name | 3-(2-chloro-5-methoxy-3-methylphenyl)-1-methyl-1-[6-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]urea |
| SMILES | COc1cc(C)c(Cl)c(NC(=O)N(C)c2cc(Nc3ccc(N4CCN(C)CC4)cc3)ncn2)c1 |
| InChI | InChI=1S/C25H30ClN7O2/c1-17-13-20(35-4)14-21(24(17)26)30-25(34)32(3)23-15-22(27-16-28-23)29-18-5-7-19(8-6-18)33-11-9-31(2)10-12-33/h5-8,13-16H,9-12H2,1-4H3,(H,30,34)(H,27,28,29) |
| InChIKey | JFPIDBNXQSQPTC-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 85.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.02 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|