C26H34N8O3 — CID 163436418
1-[6-[2-amino-4-(4-ethylpiperazin-1-yl)anilino]pyrimidin-4-yl]-3-(3,5-dimethoxyphenyl)-1-methylurea (PubChem CID 163436418) has the molecular formula C26H34N8O3 and a molecular weight of 506.61 g/mol. Its IUPAC name is 1-[6-[2-amino-4-(4-ethylpiperazin-1-yl)anilino]pyrimidin-4-yl]-3-(3,5-dimethoxyphenyl)-1-methylurea.
| Compound Name | 1-[6-[2-amino-4-(4-ethylpiperazin-1-yl)anilino]pyrimidin-4-yl]-3-(3,5-dimethoxyphenyl)-1-methylurea |
|---|---|
| PubChem CID | 163436418 |
| Molecular Formula | C26H34N8O3 |
| Molecular Weight | 506.61 g/mol |
| Exact Mass | 506.28 |
| IUPAC Name | 1-[6-[2-amino-4-(4-ethylpiperazin-1-yl)anilino]pyrimidin-4-yl]-3-(3,5-dimethoxyphenyl)-1-methylurea |
| SMILES | CCN1CCN(c2ccc(Nc3cc(N(C)C(=O)Nc4cc(OC)cc(OC)c4)ncn3)c(N)c2)CC1 |
| InChI | InChI=1S/C26H34N8O3/c1-5-33-8-10-34(11-9-33)19-6-7-23(22(27)14-19)31-24-16-25(29-17-28-24)32(2)26(35)30-18-12-20(36-3)15-21(13-18)37-4/h6-7,12-17H,5,8-11,27H2,1-4H3,(H,30,35)(H,28,29,31) |
| InChIKey | AUWIMCBBRWDTQX-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 121.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.61 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|