C26H29Cl2N7O5Sn — CID 145170649
(2,6-dichloro-3,5-dimethoxyphenyl)-[[6-[4-(4-ethylpiperazin-1-yl)-2-nitroanilino]pyrimidin-4-yl]-methylcarbamoyl]tin (PubChem CID 145170649) has the molecular formula C26H29Cl2N7O5Sn and a molecular weight of 709.18 g/mol. Its IUPAC name is (2,6-dichloro-3,5-dimethoxyphenyl)-[[6-[4-(4-ethylpiperazin-1-yl)-2-nitroanilino]pyrimidin-4-yl]-methylcarbamoyl]tin.
| Compound Name | (2,6-dichloro-3,5-dimethoxyphenyl)-[[6-[4-(4-ethylpiperazin-1-yl)-2-nitroanilino]pyrimidin-4-yl]-methylcarbamoyl]tin |
|---|---|
| PubChem CID | 145170649 |
| Molecular Formula | C26H29Cl2N7O5Sn |
| Molecular Weight | 709.18 g/mol |
| Exact Mass | 709.06 |
| IUPAC Name | (2,6-dichloro-3,5-dimethoxyphenyl)-[[6-[4-(4-ethylpiperazin-1-yl)-2-nitroanilino]pyrimidin-4-yl]-methylcarbamoyl]tin |
| SMILES | CCN1CCN(c2ccc(Nc3cc(N(C)C(=O)[Sn]c4c(Cl)c(OC)cc(OC)c4Cl)ncn3)c([N+](=O)[O-])c2)CC1 |
| InChI | InChI=1S/C18H22N7O3.C8H7Cl2O2.Sn/c1-3-23-6-8-24(9-7-23)14-4-5-15(16(10-14)25(27)28)21-17-11-18(20-12-19-17)22(2)13-26;1-11-7-4-8(12-2)6(10)3-5(7)9;/h4-5,10-12H,3,6-9H2,1-2H3,(H,19,20,21);4H,1-2H3; |
| InChIKey | NFKQREOZZRQNMC-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 126.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.18 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|