C38H39F2N5O10 — CID 152573766
(2,6-difluoro-3,5-dimethoxyphenyl)-[5-[4-(4-ethylpiperazin-1-yl)-2-nitroanilino]-3-[(3,4,5-trimethoxyphenyl)methoxy]furo[2,3-c]pyridin-2-yl]methanone (PubChem CID 152573766) has the molecular formula C38H39F2N5O10 and a molecular weight of 763.75 g/mol. Its IUPAC name is (2,6-difluoro-3,5-dimethoxyphenyl)-[5-[4-(4-ethylpiperazin-1-yl)-2-nitroanilino]-3-[(3,4,5-trimethoxyphenyl)methoxy]furo[2,3-c]pyridin-2-yl]methanone.
| Compound Name | (2,6-difluoro-3,5-dimethoxyphenyl)-[5-[4-(4-ethylpiperazin-1-yl)-2-nitroanilino]-3-[(3,4,5-trimethoxyphenyl)methoxy]furo[2,3-c]pyridin-2-yl]methanone |
|---|---|
| PubChem CID | 152573766 |
| Molecular Formula | C38H39F2N5O10 |
| Molecular Weight | 763.75 g/mol |
| Exact Mass | 763.27 |
| IUPAC Name | (2,6-difluoro-3,5-dimethoxyphenyl)-[5-[4-(4-ethylpiperazin-1-yl)-2-nitroanilino]-3-[(3,4,5-trimethoxyphenyl)methoxy]furo[2,3-c]pyridin-2-yl]methanone |
| SMILES | CCN1CCN(c2ccc(Nc3cc4c(OCc5cc(OC)c(OC)c(OC)c5)c(C(=O)c5c(F)c(OC)cc(OC)c5F)oc4cn3)c([N+](=O)[O-])c2)CC1 |
| InChI | InChI=1S/C38H39F2N5O10/c1-7-43-10-12-44(13-11-43)22-8-9-24(25(16-22)45(47)48)42-31-17-23-30(19-41-31)55-38(35(46)32-33(39)26(49-2)18-27(50-3)34(32)40)36(23)54-20-21-14-28(51-4)37(53-6)29(15-21)52-5/h8-9,14-19H,7,10-13,20H2,1-6H3,(H,41,42) |
| InChIKey | YSASJUTVXTYXST-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 160.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 763.75 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|