C34H36F3N5O8 — CID 154940234
tert-butyl N-[2-(2,6-difluoro-3,5-dimethoxybenzoyl)-5-[4-(4-fluoro-4-methylpiperidin-1-yl)-2-nitroanilino]furo[2,3-c]pyridin-3-yl]-N-methylcarbamate (PubChem CID 154940234) has the molecular formula C34H36F3N5O8 and a molecular weight of 699.68 g/mol. Its IUPAC name is tert-butyl N-[2-(2,6-difluoro-3,5-dimethoxybenzoyl)-5-[4-(4-fluoro-4-methylpiperidin-1-yl)-2-nitroanilino]furo[2,3-c]pyridin-3-yl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[2-(2,6-difluoro-3,5-dimethoxybenzoyl)-5-[4-(4-fluoro-4-methylpiperidin-1-yl)-2-nitroanilino]furo[2,3-c]pyridin-3-yl]-N-methylcarbamate |
|---|---|
| PubChem CID | 154940234 |
| Molecular Formula | C34H36F3N5O8 |
| Molecular Weight | 699.68 g/mol |
| Exact Mass | 699.25 |
| IUPAC Name | tert-butyl N-[2-(2,6-difluoro-3,5-dimethoxybenzoyl)-5-[4-(4-fluoro-4-methylpiperidin-1-yl)-2-nitroanilino]furo[2,3-c]pyridin-3-yl]-N-methylcarbamate |
| SMILES | COc1cc(OC)c(F)c(C(=O)c2oc3cnc(Nc4ccc(N5CCC(C)(F)CC5)cc4[N+](=O)[O-])cc3c2N(C)C(=O)OC(C)(C)C)c1F |
| InChI | InChI=1S/C34H36F3N5O8/c1-33(2,3)50-32(44)40(5)29-19-15-25(39-20-9-8-18(14-21(20)42(45)46)41-12-10-34(4,37)11-13-41)38-17-24(19)49-31(29)30(43)26-27(35)22(47-6)16-23(48-7)28(26)36/h8-9,14-17H,10-13H2,1-7H3,(H,38,39) |
| InChIKey | XVYKXNFOLZHFQI-UHFFFAOYSA-N |
| XLogP | 7.71 |
| TPSA | 149.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.68 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|