C28H27F2N5O6 — CID 154630030
3-(2,6-difluoro-3,5-dimethoxyphenyl)-5-[4-(4-ethylpiperazin-1-yl)-2-nitroanilino]furo[3,2-b]pyridine-2-carbaldehyde (PubChem CID 154630030) has the molecular formula C28H27F2N5O6 and a molecular weight of 567.55 g/mol. Its IUPAC name is 3-(2,6-difluoro-3,5-dimethoxyphenyl)-5-[4-(4-ethylpiperazin-1-yl)-2-nitroanilino]furo[3,2-b]pyridine-2-carbaldehyde.
| Compound Name | 3-(2,6-difluoro-3,5-dimethoxyphenyl)-5-[4-(4-ethylpiperazin-1-yl)-2-nitroanilino]furo[3,2-b]pyridine-2-carbaldehyde |
|---|---|
| PubChem CID | 154630030 |
| Molecular Formula | C28H27F2N5O6 |
| Molecular Weight | 567.55 g/mol |
| Exact Mass | 567.19 |
| IUPAC Name | 3-(2,6-difluoro-3,5-dimethoxyphenyl)-5-[4-(4-ethylpiperazin-1-yl)-2-nitroanilino]furo[3,2-b]pyridine-2-carbaldehyde |
| SMILES | CCN1CCN(c2ccc(Nc3ccc4oc(C=O)c(-c5c(F)c(OC)cc(OC)c5F)c4n3)c([N+](=O)[O-])c2)CC1 |
| InChI | InChI=1S/C28H27F2N5O6/c1-4-33-9-11-34(12-10-33)16-5-6-17(18(13-16)35(37)38)31-23-8-7-19-28(32-23)24(22(15-36)41-19)25-26(29)20(39-2)14-21(40-3)27(25)30/h5-8,13-15H,4,9-12H2,1-3H3,(H,31,32) |
| InChIKey | QNYNNJMDTUYKII-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 123.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.55 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|