C31H31F2N5O5 — CID 155058248
N-[2-[[2-(2,6-difluoro-3,5-dimethoxybenzoyl)furo[2,3-b]pyridin-6-yl]amino]-5-(4-ethylpiperazin-1-yl)phenyl]prop-2-enamide (PubChem CID 155058248) has the molecular formula C31H31F2N5O5 and a molecular weight of 591.62 g/mol. Its IUPAC name is N-[2-[[2-(2,6-difluoro-3,5-dimethoxybenzoyl)furo[2,3-b]pyridin-6-yl]amino]-5-(4-ethylpiperazin-1-yl)phenyl]prop-2-enamide.
| Compound Name | N-[2-[[2-(2,6-difluoro-3,5-dimethoxybenzoyl)furo[2,3-b]pyridin-6-yl]amino]-5-(4-ethylpiperazin-1-yl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 155058248 |
| Molecular Formula | C31H31F2N5O5 |
| Molecular Weight | 591.62 g/mol |
| Exact Mass | 591.23 |
| IUPAC Name | N-[2-[[2-(2,6-difluoro-3,5-dimethoxybenzoyl)furo[2,3-b]pyridin-6-yl]amino]-5-(4-ethylpiperazin-1-yl)phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc(N2CCN(CC)CC2)ccc1Nc1ccc2cc(C(=O)c3c(F)c(OC)cc(OC)c3F)oc2n1 |
| InChI | InChI=1S/C31H31F2N5O5/c1-5-26(39)35-21-16-19(38-13-11-37(6-2)12-14-38)8-9-20(21)34-25-10-7-18-15-24(43-31(18)36-25)30(40)27-28(32)22(41-3)17-23(42-4)29(27)33/h5,7-10,15-17H,1,6,11-14H2,2-4H3,(H,34,36)(H,35,39) |
| InChIKey | XMFGOCSTGNGGHQ-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 109.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.62 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|