C33H33F2N5O4 — CID 155058557
N-[2-[[6-(2,6-difluoro-3,5-dimethoxybenzoyl)quinolin-2-yl]amino]-5-(4-ethylpiperazin-1-yl)phenyl]prop-2-enamide (PubChem CID 155058557) has the molecular formula C33H33F2N5O4 and a molecular weight of 601.65 g/mol. Its IUPAC name is N-[2-[[6-(2,6-difluoro-3,5-dimethoxybenzoyl)quinolin-2-yl]amino]-5-(4-ethylpiperazin-1-yl)phenyl]prop-2-enamide.
| Compound Name | N-[2-[[6-(2,6-difluoro-3,5-dimethoxybenzoyl)quinolin-2-yl]amino]-5-(4-ethylpiperazin-1-yl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 155058557 |
| Molecular Formula | C33H33F2N5O4 |
| Molecular Weight | 601.65 g/mol |
| Exact Mass | 601.25 |
| IUPAC Name | N-[2-[[6-(2,6-difluoro-3,5-dimethoxybenzoyl)quinolin-2-yl]amino]-5-(4-ethylpiperazin-1-yl)phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc(N2CCN(CC)CC2)ccc1Nc1ccc2cc(C(=O)c3c(F)c(OC)cc(OC)c3F)ccc2n1 |
| InChI | InChI=1S/C33H33F2N5O4/c1-5-29(41)38-25-18-22(40-15-13-39(6-2)14-16-40)9-11-24(25)37-28-12-8-20-17-21(7-10-23(20)36-28)33(42)30-31(34)26(43-3)19-27(44-4)32(30)35/h5,7-12,17-19H,1,6,13-16H2,2-4H3,(H,36,37)(H,38,41) |
| InChIKey | APQJABMSFIOBMH-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 96.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.65 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|