C28H24Cl2N6O5 — CID 138583780
4-(2,6-dichloro-3,5-dimethoxyphenyl)-N-(4-morpholin-4-yl-2-nitrophenyl)imidazo[1,2-a][1,6]naphthyridin-8-amine (PubChem CID 138583780) has the molecular formula C28H24Cl2N6O5 and a molecular weight of 595.44 g/mol. Its IUPAC name is 4-(2,6-dichloro-3,5-dimethoxyphenyl)-N-(4-morpholin-4-yl-2-nitrophenyl)imidazo[1,2-a][1,6]naphthyridin-8-amine.
| Compound Name | 4-(2,6-dichloro-3,5-dimethoxyphenyl)-N-(4-morpholin-4-yl-2-nitrophenyl)imidazo[1,2-a][1,6]naphthyridin-8-amine |
|---|---|
| PubChem CID | 138583780 |
| Molecular Formula | C28H24Cl2N6O5 |
| Molecular Weight | 595.44 g/mol |
| Exact Mass | 594.12 |
| IUPAC Name | 4-(2,6-dichloro-3,5-dimethoxyphenyl)-N-(4-morpholin-4-yl-2-nitrophenyl)imidazo[1,2-a][1,6]naphthyridin-8-amine |
| SMILES | COc1cc(OC)c(Cl)c(-c2cc3cnc(Nc4ccc(N5CCOCC5)cc4[N+](=O)[O-])cc3n3ccnc23)c1Cl |
| InChI | InChI=1S/C28H24Cl2N6O5/c1-39-22-14-23(40-2)27(30)25(26(22)29)18-11-16-15-32-24(13-20(16)35-6-5-31-28(18)35)33-19-4-3-17(12-21(19)36(37)38)34-7-9-41-10-8-34/h3-6,11-15H,7-10H2,1-2H3,(H,32,33) |
| InChIKey | XQNHYPAHNUALTD-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 116.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.44 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|