C31H28Cl2N6O3 — CID 160832293
1-[2-[[7-(2,6-dichloro-3,5-dimethoxyphenyl)-2,5,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-12-yl]amino]-5-pyrrolidin-1-ylphenyl]but-3-en-2-one (PubChem CID 160832293) has the molecular formula C31H28Cl2N6O3 and a molecular weight of 603.51 g/mol. Its IUPAC name is 1-[2-[[7-(2,6-dichloro-3,5-dimethoxyphenyl)-2,5,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-12-yl]amino]-5-pyrrolidin-1-ylphenyl]but-3-en-2-one.
| Compound Name | 1-[2-[[7-(2,6-dichloro-3,5-dimethoxyphenyl)-2,5,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-12-yl]amino]-5-pyrrolidin-1-ylphenyl]but-3-en-2-one |
|---|---|
| PubChem CID | 160832293 |
| Molecular Formula | C31H28Cl2N6O3 |
| Molecular Weight | 603.51 g/mol |
| Exact Mass | 602.16 |
| IUPAC Name | 1-[2-[[7-(2,6-dichloro-3,5-dimethoxyphenyl)-2,5,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-12-yl]amino]-5-pyrrolidin-1-ylphenyl]but-3-en-2-one |
| SMILES | C=CC(=O)Cc1cc(N2CCCC2)ccc1Nc1ncc2cc(-c3c(Cl)c(OC)cc(OC)c3Cl)c3nccn3c2n1 |
| InChI | InChI=1S/C31H28Cl2N6O3/c1-4-21(40)14-18-13-20(38-10-5-6-11-38)7-8-23(18)36-31-35-17-19-15-22(30-34-9-12-39(30)29(19)37-31)26-27(32)24(41-2)16-25(42-3)28(26)33/h4,7-9,12-13,15-17H,1,5-6,10-11,14H2,2-3H3,(H,35,36,37) |
| InChIKey | SGYLQEBTMNOOBZ-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 93.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.51 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|